C14H25F3IN3O3 — CID 111252246
methyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111252246) has the molecular formula C14H25F3IN3O3 and a molecular weight of 467.27 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111252246 |
| Molecular Formula | C14H25F3IN3O3 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | methyl 1-[N'-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCCCOCC(F)(F)F)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C14H24F3N3O3.HI/c1-18-13(19-6-3-9-23-10-14(15,16)17)20-7-4-11(5-8-20)12(21)22-2;/h11H,3-10H2,1-2H3,(H,18,19);1H |
| InChIKey | DWNXFFJEGOWYKN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|