C31H51N5O6SSi2 — CID 11125268
[2-amino-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 11125268) has the molecular formula C31H51N5O6SSi2 and a molecular weight of 678.02 g/mol. Its IUPAC name is [2-amino-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-amino-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 11125268 |
| Molecular Formula | C31H51N5O6SSi2 |
| Molecular Weight | 678.02 g/mol |
| Exact Mass | 677.31 |
| IUPAC Name | [2-amino-9-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]purin-6-yl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2nc(N)nc3c2ncn3[C@H]2C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(C)c1 |
| InChI | InChI=1S/C31H51N5O6SSi2/c1-19-14-20(2)26(21(3)15-19)43(37,38)41-28-25-27(34-29(32)35-28)36(18-33-25)24-16-22(42-45(12,13)31(7,8)9)23(40-24)17-39-44(10,11)30(4,5)6/h14-15,18,22-24H,16-17H2,1-13H3,(H2,32,34,35)/t22-,23+,24+/m0/s1 |
| InChIKey | CMHWWKXQDNEHBQ-RBZQAINGSA-N |
| XLogP | 6.80 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.02 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|