C38H50O9Si — CID 11125275
(5R)-2,2-diethyl-5-[(R)-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-trimethylsilyloxymethyl]-1,3-dioxolan-4-one (PubChem CID 11125275) has the molecular formula C38H50O9Si and a molecular weight of 678.90 g/mol. Its IUPAC name is (5R)-2,2-diethyl-5-[(R)-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-trimethylsilyloxymethyl]-1,3-dioxolan-4-one.
| Compound Name | (5R)-2,2-diethyl-5-[(R)-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-trimethylsilyloxymethyl]-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 11125275 |
| Molecular Formula | C38H50O9Si |
| Molecular Weight | 678.90 g/mol |
| Exact Mass | 678.32 |
| IUPAC Name | (5R)-2,2-diethyl-5-[(R)-[(2S,3S,4S,5R,6S)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]-trimethylsilyloxymethyl]-1,3-dioxolan-4-one |
| SMILES | CCC1(CC)OC(=O)[C@@H]([C@H](O[Si](C)(C)C)[C@H]2O[C@H](OC)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C38H50O9Si/c1-7-38(8-2)45-34(36(39)46-38)33(47-48(4,5)6)32-30(41-24-27-18-12-9-13-19-27)31(42-25-28-20-14-10-15-21-28)35(37(40-3)44-32)43-26-29-22-16-11-17-23-29/h9-23,30-35,37H,7-8,24-26H2,1-6H3/t30-,31-,32-,33+,34+,35+,37-/m0/s1 |
| InChIKey | BLVQVTYZKSTAQW-ZXXIJNQQSA-N |
| XLogP | 6.79 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.90 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|