C22H34N4O — CID 111256231
1-ethyl-3-(4-methylcyclohexyl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine (PubChem CID 111256231) has the molecular formula C22H34N4O and a molecular weight of 370.54 g/mol. Its IUPAC name is 1-ethyl-3-(4-methylcyclohexyl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(4-methylcyclohexyl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111256231 |
| Molecular Formula | C22H34N4O |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | 1-ethyl-3-(4-methylcyclohexyl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(CN2CCCC2=O)c1)NC1CCC(C)CC1 |
| InChI | InChI=1S/C22H34N4O/c1-3-23-22(25-20-11-9-17(2)10-12-20)24-15-18-6-4-7-19(14-18)16-26-13-5-8-21(26)27/h4,6-7,14,17,20H,3,5,8-13,15-16H2,1-2H3,(H2,23,24,25) |
| InChIKey | QNZDDNCNYOUYJO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|