C21H34N4O — CID 111257153
N-tert-butyl-3-[[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]methyl]benzamide (PubChem CID 111257153) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is N-tert-butyl-3-[[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-tert-butyl-3-[[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111257153 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | N-tert-butyl-3-[[[N'-methyl-N-(4-methylcyclohexyl)carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1cccc(C(=O)NC(C)(C)C)c1)NC1CCC(C)CC1 |
| InChI | InChI=1S/C21H34N4O/c1-15-9-11-18(12-10-15)24-20(22-5)23-14-16-7-6-8-17(13-16)19(26)25-21(2,3)4/h6-8,13,15,18H,9-12,14H2,1-5H3,(H,25,26)(H2,22,23,24) |
| InChIKey | WIZBHXNXWWMXRG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|