C17H21IN4OS — CID 111258434
1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111258434) has the molecular formula C17H21IN4OS and a molecular weight of 456.35 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111258434 |
| Molecular Formula | C17H21IN4OS |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-2-methyl-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCc2ccccc21)NCc1cccs1.I |
| InChI | InChI=1S/C17H20N4OS.HI/c1-18-17(19-11-14-6-4-10-23-14)20-12-16(22)21-9-8-13-5-2-3-7-15(13)21;/h2-7,10H,8-9,11-12H2,1H3,(H2,18,19,20);1H |
| InChIKey | BOZPUPLAAZWTFN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|