C16H18F3N3OS — CID 111258977
2-methyl-1-(thiophen-2-ylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111258977) has the molecular formula C16H18F3N3OS and a molecular weight of 357.40 g/mol. Its IUPAC name is 2-methyl-1-(thiophen-2-ylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-(thiophen-2-ylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111258977 |
| Molecular Formula | C16H18F3N3OS |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 2-methyl-1-(thiophen-2-ylmethyl)-3-[[2-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1cccs1)NCc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C16H18F3N3OS/c1-20-15(22-10-13-6-4-8-24-13)21-9-12-5-2-3-7-14(12)23-11-16(17,18)19/h2-8H,9-11H2,1H3,(H2,20,21,22) |
| InChIKey | FRULNBTYBLAQRF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|