C19H33N5 — CID 111260529
1-[2-(dimethylamino)-2-phenylethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine (PubChem CID 111260529) has the molecular formula C19H33N5 and a molecular weight of 331.51 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-2-phenylethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(dimethylamino)-2-phenylethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111260529 |
| Molecular Formula | C19H33N5 |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | 1-[2-(dimethylamino)-2-phenylethyl]-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylguanidine |
| SMILES | CCN1CCCC1CN/C(=N\C)NCC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C19H33N5/c1-5-24-13-9-12-17(24)14-21-19(20-2)22-15-18(23(3)4)16-10-7-6-8-11-16/h6-8,10-11,17-18H,5,9,12-15H2,1-4H3,(H2,20,21,22) |
| InChIKey | VOLHEOBIRKODEH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|