About dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine
dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine (PubChem CID 11126212) has the molecular formula C5H12Li2N2
and a molecular weight of 114.05 g/mol. Its IUPAC name is dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine |
|---|
| PubChem CID | 11126212 |
|---|
| Molecular Formula | C5H12Li2N2 |
|---|
| Molecular Weight | 114.05 g/mol |
|---|
| Exact Mass | 114.13 |
|---|
| IUPAC Name | dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine |
|---|
| SMILES | [CH2-]N(C)CN([CH2-])C.[Li+].[Li+] |
|---|
| InChI | InChI=1S/C5H12N2.2Li/c1-6(2)5-7(3)4;;/h1,3,5H2,2,4H3;;/q-2;2*+1 |
|---|
| InChIKey | HRISTIWTKIVSBU-UHFFFAOYSA-N |
|---|
| XLogP | -5.60 |
|---|
| TPSA | 6.48 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 2 |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 114.05 |
| LogP ≤ 5 | -5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine?
The IUPAC name of dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine (CID 11126212) is dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine.
What is the SMILES notation for dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine?
The canonical SMILES for dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine is [CH2-]N(C)CN([CH2-])C.[Li+].[Li+].
What is the InChIKey of dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine?
The InChIKey is HRISTIWTKIVSBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.2Li/c1-6(2)5-7(3)4;;/h1,3,5H2,2,4H3;;/q-2;2*+1.
What are the key properties of dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine?
dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine has a molecular weight of 114.05 g/mol, XLogP of -5.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;N,N'-dimethanidyl-N,N'-dimethylmethanediamine is sourced from PubChem (CID 11126212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).