C17H29N5 — CID 111262315
1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]guanidine (PubChem CID 111262315) has the molecular formula C17H29N5 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111262315 |
| Molecular Formula | C17H29N5 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(6-methyl-2-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(C)n1)NCC1CCCN1CC |
| InChI | InChI=1S/C17H29N5/c1-4-18-17(19-12-15-9-6-8-14(3)21-15)20-13-16-10-7-11-22(16)5-2/h6,8-9,16H,4-5,7,10-13H2,1-3H3,(H2,18,19,20) |
| InChIKey | PVZYEZBRWPDVGB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|