C20H36IN5O2S — CID 111262544
1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111262544) has the molecular formula C20H36IN5O2S and a molecular weight of 537.51 g/mol. Its IUPAC name is 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111262544 |
| Molecular Formula | C20H36IN5O2S |
| Molecular Weight | 537.51 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 1-[(1-ethylpyrrolidin-2-yl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN1CCCC1CN/C(=N\C)NCc1ccc(CS(=O)(=O)NC(C)C)cc1.I |
| InChI | InChI=1S/C20H35N5O2S.HI/c1-5-25-12-6-7-19(25)14-23-20(21-4)22-13-17-8-10-18(11-9-17)15-28(26,27)24-16(2)3;/h8-11,16,19,24H,5-7,12-15H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | LCXVMENSUIVGJK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.51 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|