C8H10O2 — CID 11126324
(1S,2R)-3-ethenylcyclohexa-3,5-diene-1,2-diol (PubChem CID 11126324) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is (1S,2R)-3-ethenylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | (1S,2R)-3-ethenylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 11126324 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (1S,2R)-3-ethenylcyclohexa-3,5-diene-1,2-diol |
| SMILES | C=CC1=CC=C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H10O2/c1-2-6-4-3-5-7(9)8(6)10/h2-5,7-10H,1H2/t7-,8+/m0/s1 |
| InChIKey | VQKKVCTZENPFCZ-JGVFFNPUSA-N |
| XLogP | 0.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |