About (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one
(2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one (PubChem CID 11126388) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one.
Molecular Properties
| Compound Name | (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one |
| PubChem CID | 11126388 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=CO[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C6H8O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,5-7,9H,3H2/t5-,6+/m1/s1 |
| InChIKey | DRFLVTOPHKTQAY-RITPCOANSA-N |
| XLogP | -1.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
The IUPAC name of (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one (CID 11126388) is (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one.
What is the SMILES notation for (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
The canonical SMILES for (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one is O=C1C=CO[C@H](CO)[C@H]1O.
What is the InChIKey of (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
The InChIKey is DRFLVTOPHKTQAY-RITPCOANSA-N. The full InChI is InChI=1S/C6H8O4/c7-3-5-6(9)4(8)1-2-10-5/h1-2,5-7,9H,3H2/t5-,6+/m1/s1.
What are the key properties of (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one?
(2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one has a molecular weight of 144.13 g/mol, XLogP of -1.18, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-hydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4-one is sourced from PubChem (CID 11126388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).