C7H12O3 — CID 11126390
(2S,3R,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11126390) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (2S,3R,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3R,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11126390 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (2S,3R,6R)-6-methoxy-2-methyl-3,6-dihydro-2H-pyran-3-ol |
| SMILES | CO[C@H]1C=C[C@@H](O)[C@H](C)O1 |
| InChI | InChI=1S/C7H12O3/c1-5-6(8)3-4-7(9-2)10-5/h3-8H,1-2H3/t5-,6+,7+/m0/s1 |
| InChIKey | BPAHQTJCFQUBHC-RRKCRQDMSA-N |
| XLogP | 0.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|