About nonane-2,5-dione
nonane-2,5-dione (PubChem CID 11126503) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is nonane-2,5-dione.
Molecular Properties
| Compound Name | nonane-2,5-dione |
| PubChem CID | 11126503 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | nonane-2,5-dione |
| SMILES | CCCCC(=O)CCC(C)=O |
| InChI | InChI=1S/C9H16O2/c1-3-4-5-9(11)7-6-8(2)10/h3-7H2,1-2H3 |
| InChIKey | LWOMTZPPFKJNPA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze nonane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonane-2,5-dione?
The IUPAC name of nonane-2,5-dione (CID 11126503) is nonane-2,5-dione.
What is the SMILES notation for nonane-2,5-dione?
The canonical SMILES for nonane-2,5-dione is CCCCC(=O)CCC(C)=O.
What is the InChIKey of nonane-2,5-dione?
The InChIKey is LWOMTZPPFKJNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-4-5-9(11)7-6-8(2)10/h3-7H2,1-2H3.
What are the key properties of nonane-2,5-dione?
nonane-2,5-dione has a molecular weight of 156.22 g/mol, XLogP of 2.11, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonane-2,5-dione is sourced from PubChem (CID 11126503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).