About 2-nitroethylcyclohexane
2-nitroethylcyclohexane (PubChem CID 11126523) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 2-nitroethylcyclohexane.
Molecular Properties
| Compound Name | 2-nitroethylcyclohexane |
| PubChem CID | 11126523 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 2-nitroethylcyclohexane |
| SMILES | O=[N+]([O-])CCC1CCCCC1 |
| InChI | InChI=1S/C8H15NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h8H,1-7H2 |
| InChIKey | FAYKNVFWQRGUFR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethylcyclohexane?
The IUPAC name of 2-nitroethylcyclohexane (CID 11126523) is 2-nitroethylcyclohexane.
What is the SMILES notation for 2-nitroethylcyclohexane?
The canonical SMILES for 2-nitroethylcyclohexane is O=[N+]([O-])CCC1CCCCC1.
What is the InChIKey of 2-nitroethylcyclohexane?
The InChIKey is FAYKNVFWQRGUFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c10-9(11)7-6-8-4-2-1-3-5-8/h8H,1-7H2.
What are the key properties of 2-nitroethylcyclohexane?
2-nitroethylcyclohexane has a molecular weight of 157.21 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethylcyclohexane is sourced from PubChem (CID 11126523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).