About 2-methyl-5-phenylfuran
2-methyl-5-phenylfuran (PubChem CID 11126536) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-methyl-5-phenylfuran.
Molecular Properties
| Compound Name | 2-methyl-5-phenylfuran |
| PubChem CID | 11126536 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 2-methyl-5-phenylfuran |
| SMILES | Cc1ccc(-c2ccccc2)o1 |
| InChI | InChI=1S/C11H10O/c1-9-7-8-11(12-9)10-5-3-2-4-6-10/h2-8H,1H3 |
| InChIKey | PQYQNYWJAXBMEL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-5-phenylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-phenylfuran?
The IUPAC name of 2-methyl-5-phenylfuran (CID 11126536) is 2-methyl-5-phenylfuran.
What is the SMILES notation for 2-methyl-5-phenylfuran?
The canonical SMILES for 2-methyl-5-phenylfuran is Cc1ccc(-c2ccccc2)o1.
What is the InChIKey of 2-methyl-5-phenylfuran?
The InChIKey is PQYQNYWJAXBMEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c1-9-7-8-11(12-9)10-5-3-2-4-6-10/h2-8H,1H3.
What are the key properties of 2-methyl-5-phenylfuran?
2-methyl-5-phenylfuran has a molecular weight of 158.20 g/mol, XLogP of 3.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-phenylfuran is sourced from PubChem (CID 11126536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).