C15H18FN3S — CID 111266089
1-[(2-fluorophenyl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine (PubChem CID 111266089) has the molecular formula C15H18FN3S and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111266089 |
| Molecular Formula | C15H18FN3S |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-(2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1cccs1)NCc1ccccc1F |
| InChI | InChI=1S/C15H18FN3S/c1-17-15(18-9-8-13-6-4-10-20-13)19-11-12-5-2-3-7-14(12)16/h2-7,10H,8-9,11H2,1H3,(H2,17,18,19) |
| InChIKey | TVWAGYCLAJBQNJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|