C10H14O2 — CID 11126640
(3E,3aS,7aR)-3-prop-2-enylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran (PubChem CID 11126640) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3E,3aS,7aR)-3-prop-2-enylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran.
| Compound Name | (3E,3aS,7aR)-3-prop-2-enylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
|---|---|
| PubChem CID | 11126640 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3E,3aS,7aR)-3-prop-2-enylidene-4,5,6,7a-tetrahydro-3aH-furo[2,3-b]pyran |
| SMILES | C=C/C=C1/CO[C@H]2OCCC[C@@H]12 |
| InChI | InChI=1S/C10H14O2/c1-2-4-8-7-12-10-9(8)5-3-6-11-10/h2,4,9-10H,1,3,5-7H2/b8-4-/t9-,10+/m0/s1 |
| InChIKey | OOLQQZJOQKDJGT-YXCTTXFESA-N |
| XLogP | 1.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |