C11H18O — CID 11126645
[(2Z,6Z)-4-methylcyclonona-2,6-dien-1-yl]methanol (PubChem CID 11126645) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is [(2Z,6Z)-4-methylcyclonona-2,6-dien-1-yl]methanol.
| Compound Name | [(2Z,6Z)-4-methylcyclonona-2,6-dien-1-yl]methanol |
|---|---|
| PubChem CID | 11126645 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | [(2Z,6Z)-4-methylcyclonona-2,6-dien-1-yl]methanol |
| SMILES | CC1/C=C\C(CO)CC/C=C\C1 |
| InChI | InChI=1S/C11H18O/c1-10-5-3-2-4-6-11(9-12)8-7-10/h2-3,7-8,10-12H,4-6,9H2,1H3/b3-2-,8-7- |
| InChIKey | PPCLRUCOWZPZJB-BLEQRIPJSA-N |
| XLogP | 2.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|