C22H28FN5O — CID 111266609
1-[(2-fluorophenyl)methyl]-2-methyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine (PubChem CID 111266609) has the molecular formula C22H28FN5O and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-2-methyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111266609 |
| Molecular Formula | C22H28FN5O |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine |
| SMILES | C/N=C(/NCCC(=O)N1CCN(c2ccccc2)CC1)NCc1ccccc1F |
| InChI | InChI=1S/C22H28FN5O/c1-24-22(26-17-18-7-5-6-10-20(18)23)25-12-11-21(29)28-15-13-27(14-16-28)19-8-3-2-4-9-19/h2-10H,11-17H2,1H3,(H2,24,25,26) |
| InChIKey | YVBVEVKUULBUNC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|