C5H12N2O2 — CID 11126680
(2R,3R,4S)-2-(aminomethyl)pyrrolidine-3,4-diol (PubChem CID 11126680) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is (2R,3R,4S)-2-(aminomethyl)pyrrolidine-3,4-diol.
| Compound Name | (2R,3R,4S)-2-(aminomethyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 11126680 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | (2R,3R,4S)-2-(aminomethyl)pyrrolidine-3,4-diol |
| SMILES | NC[C@H]1NC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H12N2O2/c6-1-3-5(9)4(8)2-7-3/h3-5,7-9H,1-2,6H2/t3-,4+,5-/m1/s1 |
| InChIKey | PTUICKYMXFZVGV-MROZADKFSA-N |
| XLogP | -2.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |