About 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione
1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione (PubChem CID 11126684) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione.
Molecular Properties
| Compound Name | 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione |
| PubChem CID | 11126684 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione |
| SMILES | CCN1C(=O)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C8H11NO3/c1-4-9-6(11)5(10)8(2,3)7(9)12/h4H2,1-3H3 |
| InChIKey | MHRDLZBXLQEOCC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione?
The IUPAC name of 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione (CID 11126684) is 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione.
What is the SMILES notation for 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione?
The canonical SMILES for 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione is CCN1C(=O)C(=O)C(C)(C)C1=O.
What is the InChIKey of 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione?
The InChIKey is MHRDLZBXLQEOCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-4-9-6(11)5(10)8(2,3)7(9)12/h4H2,1-3H3.
What are the key properties of 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione?
1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione has a molecular weight of 169.18 g/mol, XLogP of -0.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,4-dimethylpyrrolidine-2,3,5-trione is sourced from PubChem (CID 11126684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).