About 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione
4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione (PubChem CID 11126720) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione.
Molecular Properties
| Compound Name | 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione |
| PubChem CID | 11126720 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione |
| SMILES | CC(C)(C)C1(C)NC(=O)OC1=O |
| InChI | InChI=1S/C8H13NO3/c1-7(2,3)8(4)5(10)12-6(11)9-8/h1-4H3,(H,9,11) |
| InChIKey | WRVGDWHHJJKQDU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione?
The IUPAC name of 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione (CID 11126720) is 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione.
What is the SMILES notation for 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione?
The canonical SMILES for 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione is CC(C)(C)C1(C)NC(=O)OC1=O.
What is the InChIKey of 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione?
The InChIKey is WRVGDWHHJJKQDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-7(2,3)8(4)5(10)12-6(11)9-8/h1-4H3,(H,9,11).
What are the key properties of 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione?
4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione has a molecular weight of 171.20 g/mol, XLogP of 1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-4-methyl-1,3-oxazolidine-2,5-dione is sourced from PubChem (CID 11126720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).