C16H26F3IN4O2S — CID 111267426
1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111267426) has the molecular formula C16H26F3IN4O2S and a molecular weight of 522.38 g/mol. Its IUPAC name is 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111267426 |
| Molecular Formula | C16H26F3IN4O2S |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 522.08 |
| IUPAC Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCS(=O)(=O)N(C)CCCN/C(=N\C)NCc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C16H25F3N4O2S.HI/c1-4-26(24,25)23(3)10-6-9-21-15(20-2)22-12-13-7-5-8-14(11-13)16(17,18)19;/h5,7-8,11H,4,6,9-10,12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | URKVHKWSYDQTME-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|