About 2-phenyl-1,3-dioxan-5-amine
2-phenyl-1,3-dioxan-5-amine (PubChem CID 11126841) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-phenyl-1,3-dioxan-5-amine.
Molecular Properties
| Compound Name | 2-phenyl-1,3-dioxan-5-amine |
| PubChem CID | 11126841 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-phenyl-1,3-dioxan-5-amine |
| SMILES | NC1COC(c2ccccc2)OC1 |
| InChI | InChI=1S/C10H13NO2/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-5,9-10H,6-7,11H2 |
| InChIKey | XXLVLPPHZWTLGD-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenyl-1,3-dioxan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1,3-dioxan-5-amine?
The IUPAC name of 2-phenyl-1,3-dioxan-5-amine (CID 11126841) is 2-phenyl-1,3-dioxan-5-amine.
What is the SMILES notation for 2-phenyl-1,3-dioxan-5-amine?
The canonical SMILES for 2-phenyl-1,3-dioxan-5-amine is NC1COC(c2ccccc2)OC1.
What is the InChIKey of 2-phenyl-1,3-dioxan-5-amine?
The InChIKey is XXLVLPPHZWTLGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-5,9-10H,6-7,11H2.
What are the key properties of 2-phenyl-1,3-dioxan-5-amine?
2-phenyl-1,3-dioxan-5-amine has a molecular weight of 179.22 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1,3-dioxan-5-amine is sourced from PubChem (CID 11126841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).