C9H12O4 — CID 11126938
(1S,2R,4S,5R)-1-methoxy-5-methyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-one (PubChem CID 11126938) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (1S,2R,4S,5R)-1-methoxy-5-methyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-one.
| Compound Name | (1S,2R,4S,5R)-1-methoxy-5-methyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-one |
|---|---|
| PubChem CID | 11126938 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1S,2R,4S,5R)-1-methoxy-5-methyl-3,9-dioxatricyclo[3.3.1.02,4]nonan-7-one |
| SMILES | CO[C@@]12CC(=O)C[C@@](C)(O1)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C9H12O4/c1-8-3-5(10)4-9(11-2,13-8)7-6(8)12-7/h6-7H,3-4H2,1-2H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | YHNMQDOWGYNWSN-KDXUFGMBSA-N |
| XLogP | 0.25 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|