C18H30IN3O4S — CID 111269480
N-ethyl-N'-(2-ethylsulfonylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 111269480) has the molecular formula C18H30IN3O4S and a molecular weight of 511.43 g/mol. Its IUPAC name is N-ethyl-N'-(2-ethylsulfonylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(2-ethylsulfonylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111269480 |
| Molecular Formula | C18H30IN3O4S |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | N-ethyl-N'-(2-ethylsulfonylethyl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)CC)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C18H29N3O4S.HI/c1-5-19-18(20-8-10-26(22,23)6-2)21-9-7-14-11-16(24-3)17(25-4)12-15(14)13-21;/h11-12H,5-10,13H2,1-4H3,(H,19,20);1H |
| InChIKey | OXXZSRPZLQTWSV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|