About cyclopenta[f][1,3]benzodioxole-5,7-dione
cyclopenta[f][1,3]benzodioxole-5,7-dione (PubChem CID 11127061) has the molecular formula C10H6O4
and a molecular weight of 190.15 g/mol. Its IUPAC name is cyclopenta[f][1,3]benzodioxole-5,7-dione.
Molecular Properties
| Compound Name | cyclopenta[f][1,3]benzodioxole-5,7-dione |
| PubChem CID | 11127061 |
| Molecular Formula | C10H6O4 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | cyclopenta[f][1,3]benzodioxole-5,7-dione |
| SMILES | O=C1CC(=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C10H6O4/c11-7-3-8(12)6-2-10-9(1-5(6)7)13-4-14-10/h1-2H,3-4H2 |
| InChIKey | PWQUZAZGPKGAQJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta[f][1,3]benzodioxole-5,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta[f][1,3]benzodioxole-5,7-dione?
The IUPAC name of cyclopenta[f][1,3]benzodioxole-5,7-dione (CID 11127061) is cyclopenta[f][1,3]benzodioxole-5,7-dione.
What is the SMILES notation for cyclopenta[f][1,3]benzodioxole-5,7-dione?
The canonical SMILES for cyclopenta[f][1,3]benzodioxole-5,7-dione is O=C1CC(=O)c2cc3c(cc21)OCO3.
What is the InChIKey of cyclopenta[f][1,3]benzodioxole-5,7-dione?
The InChIKey is PWQUZAZGPKGAQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O4/c11-7-3-8(12)6-2-10-9(1-5(6)7)13-4-14-10/h1-2H,3-4H2.
What are the key properties of cyclopenta[f][1,3]benzodioxole-5,7-dione?
cyclopenta[f][1,3]benzodioxole-5,7-dione has a molecular weight of 190.15 g/mol, XLogP of 1.18, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta[f][1,3]benzodioxole-5,7-dione is sourced from PubChem (CID 11127061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).