C22H27FN4O3 — CID 111271125
N-[2-[[N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide (PubChem CID 111271125) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is N-[2-[[N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[2-[[N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111271125 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-[2-[[N'-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-N-ethylcarbamimidoyl]amino]ethyl]-2-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC1COc2ccccc2O1)NCCNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN4O3/c1-2-24-22(27-14-18-15-29-19-5-3-4-6-20(19)30-18)26-12-11-25-21(28)13-16-7-9-17(23)10-8-16/h3-10,18H,2,11-15H2,1H3,(H,25,28)(H2,24,26,27) |
| InChIKey | MMJUHYQUUZFODL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|