C24H33IN4O2 — CID 111271226
3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111271226) has the molecular formula C24H33IN4O2 and a molecular weight of 536.46 g/mol. Its IUPAC name is 3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111271226 |
| Molecular Formula | C24H33IN4O2 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 3-ethyl-1-[(4-methoxyphenyl)methyl]-1-methyl-2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CN1CCCC1=O)N(C)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C24H32N4O2.HI/c1-4-25-24(27(2)17-19-11-13-22(30-3)14-12-19)26-16-20-8-5-6-9-21(20)18-28-15-7-10-23(28)29;/h5-6,8-9,11-14H,4,7,10,15-18H2,1-3H3,(H,25,26);1H |
| InChIKey | VEDIZGNPPMQBGO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|