C19H26IN3O2 — CID 111271914
1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111271914) has the molecular formula C19H26IN3O2 and a molecular weight of 455.34 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111271914 |
| Molecular Formula | C19H26IN3O2 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-1,2-dimethyl-3-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1ccccc1)N(C)Cc1ccc(OC)cc1.I |
| InChI | InChI=1S/C19H25N3O2.HI/c1-20-19(21-13-14-24-18-7-5-4-6-8-18)22(2)15-16-9-11-17(23-3)12-10-16;/h4-12H,13-15H2,1-3H3,(H,20,21);1H |
| InChIKey | PFPBZUAYGFHAJX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|