About (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one
(2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one (PubChem CID 11127289) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one.
Molecular Properties
| Compound Name | (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one |
| PubChem CID | 11127289 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one |
| SMILES | CCCCCC[C@@H]1OC(=O)C[C@H](C)O1 |
| InChI | InChI=1S/C11H20O3/c1-3-4-5-6-7-11-13-9(2)8-10(12)14-11/h9,11H,3-8H2,1-2H3/t9-,11-/m0/s1 |
| InChIKey | FZGMWKDZSJLYDG-ONGXEEELSA-N |
| XLogP | 2.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one?
The IUPAC name of (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one (CID 11127289) is (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one.
What is the SMILES notation for (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one?
The canonical SMILES for (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one is CCCCCC[C@@H]1OC(=O)C[C@H](C)O1.
What is the InChIKey of (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one?
The InChIKey is FZGMWKDZSJLYDG-ONGXEEELSA-N. The full InChI is InChI=1S/C11H20O3/c1-3-4-5-6-7-11-13-9(2)8-10(12)14-11/h9,11H,3-8H2,1-2H3/t9-,11-/m0/s1.
What are the key properties of (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one?
(2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one has a molecular weight of 200.28 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-2-hexyl-6-methyl-1,3-dioxan-4-one is sourced from PubChem (CID 11127289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).