C9H16ClNO2 — CID 11127416
(4S,5R,6S)-4-(chloromethyl)-6-methyl-5-propan-2-yl-1,3-oxazinan-2-one (PubChem CID 11127416) has the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. Its IUPAC name is (4S,5R,6S)-4-(chloromethyl)-6-methyl-5-propan-2-yl-1,3-oxazinan-2-one.
| Compound Name | (4S,5R,6S)-4-(chloromethyl)-6-methyl-5-propan-2-yl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 11127416 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.68 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (4S,5R,6S)-4-(chloromethyl)-6-methyl-5-propan-2-yl-1,3-oxazinan-2-one |
| SMILES | CC(C)[C@H]1[C@H](C)OC(=O)N[C@@H]1CCl |
| InChI | InChI=1S/C9H16ClNO2/c1-5(2)8-6(3)13-9(12)11-7(8)4-10/h5-8H,4H2,1-3H3,(H,11,12)/t6-,7+,8-/m0/s1 |
| InChIKey | HXBJGTPMYILSSF-RNJXMRFFSA-N |
| XLogP | 1.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|