C23H32N4O2 — CID 111274343
4-[[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]-N,N-diethylbenzamide (PubChem CID 111274343) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]-N,N-diethylbenzamide.
| Compound Name | 4-[[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 111274343 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 4-[[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(CN/C(=N/C)N(C)CCOc2ccccc2)cc1 |
| InChI | InChI=1S/C23H32N4O2/c1-5-27(6-2)22(28)20-14-12-19(13-15-20)18-25-23(24-3)26(4)16-17-29-21-10-8-7-9-11-21/h7-15H,5-6,16-18H2,1-4H3,(H,24,25) |
| InChIKey | CCNNHQDGKZKWTO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|