About N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide
N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide (PubChem CID 11127606) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide.
Molecular Properties
| Compound Name | N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide |
| PubChem CID | 11127606 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide |
| SMILES | CNC(=O)C1(C)C(=O)NC(=O)N1C(C)C |
| InChI | InChI=1S/C9H15N3O3/c1-5(2)12-8(15)11-7(14)9(12,3)6(13)10-4/h5H,1-4H3,(H,10,13)(H,11,14,15) |
| InChIKey | OCRMFIADNLNYMI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide?
The IUPAC name of N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide (CID 11127606) is N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide.
What is the SMILES notation for N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide?
The canonical SMILES for N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide is CNC(=O)C1(C)C(=O)NC(=O)N1C(C)C.
What is the InChIKey of N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide?
The InChIKey is OCRMFIADNLNYMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-5(2)12-8(15)11-7(14)9(12,3)6(13)10-4/h5H,1-4H3,(H,10,13)(H,11,14,15).
What are the key properties of N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide?
N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide has a molecular weight of 213.24 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethyl-2,5-dioxo-3-propan-2-ylimidazolidine-4-carboxamide is sourced from PubChem (CID 11127606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).