About methyl 9-hydroxyundec-10-enoate
methyl 9-hydroxyundec-10-enoate (PubChem CID 11127632) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is methyl 9-hydroxyundec-10-enoate.
Molecular Properties
| Compound Name | methyl 9-hydroxyundec-10-enoate |
| PubChem CID | 11127632 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | methyl 9-hydroxyundec-10-enoate |
| SMILES | C=CC(O)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C12H22O3/c1-3-11(13)9-7-5-4-6-8-10-12(14)15-2/h3,11,13H,1,4-10H2,2H3 |
| InChIKey | PWNLKRFZLKKZTP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-hydroxyundec-10-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-hydroxyundec-10-enoate?
The IUPAC name of methyl 9-hydroxyundec-10-enoate (CID 11127632) is methyl 9-hydroxyundec-10-enoate.
What is the SMILES notation for methyl 9-hydroxyundec-10-enoate?
The canonical SMILES for methyl 9-hydroxyundec-10-enoate is C=CC(O)CCCCCCCC(=O)OC.
What is the InChIKey of methyl 9-hydroxyundec-10-enoate?
The InChIKey is PWNLKRFZLKKZTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-3-11(13)9-7-5-4-6-8-10-12(14)15-2/h3,11,13H,1,4-10H2,2H3.
What are the key properties of methyl 9-hydroxyundec-10-enoate?
methyl 9-hydroxyundec-10-enoate has a molecular weight of 214.30 g/mol, XLogP of 2.44, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-hydroxyundec-10-enoate is sourced from PubChem (CID 11127632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).