C16H27IN4O2 — CID 111277048
N,N-dimethyl-3-[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111277048) has the molecular formula C16H27IN4O2 and a molecular weight of 434.32 g/mol. Its IUPAC name is N,N-dimethyl-3-[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N,N-dimethyl-3-[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111277048 |
| Molecular Formula | C16H27IN4O2 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N,N-dimethyl-3-[[N'-methyl-N-[2-(4-methylphenoxy)ethyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc(C)cc1)NCCC(=O)N(C)C.I |
| InChI | InChI=1S/C16H26N4O2.HI/c1-13-5-7-14(8-6-13)22-12-11-19-16(17-2)18-10-9-15(21)20(3)4;/h5-8H,9-12H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | CMYZZWDZJYLIDN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|