C22H32FN5O — CID 111277895
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine (PubChem CID 111277895) has the molecular formula C22H32FN5O and a molecular weight of 401.53 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111277895 |
| Molecular Formula | C22H32FN5O |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCC1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C22H32FN5O/c1-17-15-18(2)28(27-17)12-4-11-25-21(24-3)26-16-22(9-13-29-14-10-22)19-5-7-20(23)8-6-19/h5-8,15H,4,9-14,16H2,1-3H3,(H2,24,25,26) |
| InChIKey | NIVGMRKIWKCZLA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|