C20H26N6 — CID 111278023
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine (PubChem CID 111278023) has the molecular formula C20H26N6 and a molecular weight of 350.47 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111278023 |
| Molecular Formula | C20H26N6 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-(quinolin-8-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCc1cccc2cccnc12 |
| InChI | InChI=1S/C20H26N6/c1-15-13-16(2)26(25-15)12-6-11-23-20(21-3)24-14-18-8-4-7-17-9-5-10-22-19(17)18/h4-5,7-10,13H,6,11-12,14H2,1-3H3,(H2,21,23,24) |
| InChIKey | IUBHMEKZMGPCDU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|