C17H29IN6S — CID 111278042
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111278042) has the molecular formula C17H29IN6S and a molecular weight of 476.43 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111278042 |
| Molecular Formula | C17H29IN6S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(2-ethyl-1,3-thiazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nc(CCN/C(=N\C)NCCCn2nc(C)cc2C)cs1.I |
| InChI | InChI=1S/C17H28N6S.HI/c1-5-16-21-15(12-24-16)7-9-20-17(18-4)19-8-6-10-23-14(3)11-13(2)22-23;/h11-12H,5-10H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | VGCYMRCDTXQWGX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|