C16H25N5S — CID 111278789
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111278789) has the molecular formula C16H25N5S and a molecular weight of 319.48 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111278789 |
| Molecular Formula | C16H25N5S |
| Molecular Weight | 319.48 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCCn1nc(C)cc1C)NCc1ccc(C)s1 |
| InChI | InChI=1S/C16H25N5S/c1-12-10-13(2)21(20-12)9-5-8-18-16(17-4)19-11-15-7-6-14(3)22-15/h6-7,10H,5,8-9,11H2,1-4H3,(H2,17,18,19) |
| InChIKey | VHOPIGGGNJYKIQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|