C14H22O2 — CID 11127884
(3aR,6aS)-5',5'-dimethyl-5-methylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxane] (PubChem CID 11127884) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (3aR,6aS)-5',5'-dimethyl-5-methylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxane].
| Compound Name | (3aR,6aS)-5',5'-dimethyl-5-methylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxane] |
|---|---|
| PubChem CID | 11127884 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (3aR,6aS)-5',5'-dimethyl-5-methylidenespiro[1,3,3a,4,6,6a-hexahydropentalene-2,2'-1,3-dioxane] |
| SMILES | C=C1C[C@@H]2CC3(C[C@@H]2C1)OCC(C)(C)CO3 |
| InChI | InChI=1S/C14H22O2/c1-10-4-11-6-14(7-12(11)5-10)15-8-13(2,3)9-16-14/h11-12H,1,4-9H2,2-3H3/t11-,12+ |
| InChIKey | NHWWYYZKJAVPNW-TXEJJXNPSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|