C14H22O2 — CID 11127887
(2S,3R,5R)-2,3-dimethyl-2-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 11127887) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (2S,3R,5R)-2,3-dimethyl-2-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | (2S,3R,5R)-2,3-dimethyl-2-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 11127887 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (2S,3R,5R)-2,3-dimethyl-2-(2-oxopropyl)-5-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@H]1CC(=O)[C@@](C)(CC(C)=O)[C@H](C)C1 |
| InChI | InChI=1S/C14H22O2/c1-9(2)12-6-10(3)14(5,8-11(4)15)13(16)7-12/h10,12H,1,6-8H2,2-5H3/t10-,12-,14+/m1/s1 |
| InChIKey | HJIVMEWFRDWQPI-QKCSRTOESA-N |
| XLogP | 3.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|