C19H37N7 — CID 111279331
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine (PubChem CID 111279331) has the molecular formula C19H37N7 and a molecular weight of 363.55 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111279331 |
| Molecular Formula | C19H37N7 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.31 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-2-methylguanidine |
| SMILES | CCN1CCN(C(C)CN/C(=N/C)NCCCn2nc(C)cc2C)CC1 |
| InChI | InChI=1S/C19H37N7/c1-6-24-10-12-25(13-11-24)18(4)15-22-19(20-5)21-8-7-9-26-17(3)14-16(2)23-26/h14,18H,6-13,15H2,1-5H3,(H2,20,21,22) |
| InChIKey | IFTBJZHOUUNMAH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 60.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|