About 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid
3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid (PubChem CID 11128065) has the molecular formula C12H20O2S
and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid.
Molecular Properties
| Compound Name | 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid |
| PubChem CID | 11128065 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid |
| SMILES | CC/C=C\C/C=C\CCSCCC(=O)O |
| InChI | InChI=1S/C12H20O2S/c1-2-3-4-5-6-7-8-10-15-11-9-12(13)14/h3-4,6-7H,2,5,8-11H2,1H3,(H,13,14)/b4-3-,7-6- |
| InChIKey | NPLJCVKGDPWCAE-CWWKMNTPSA-N |
| XLogP | 3.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid?
The IUPAC name of 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid (CID 11128065) is 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid.
What is the SMILES notation for 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid?
The canonical SMILES for 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid is CC/C=C\C/C=C\CCSCCC(=O)O.
What is the InChIKey of 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid?
The InChIKey is NPLJCVKGDPWCAE-CWWKMNTPSA-N. The full InChI is InChI=1S/C12H20O2S/c1-2-3-4-5-6-7-8-10-15-11-9-12(13)14/h3-4,6-7H,2,5,8-11H2,1H3,(H,13,14)/b4-3-,7-6-.
What are the key properties of 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid?
3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid has a molecular weight of 228.36 g/mol, XLogP of 3.50, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3Z,6Z)-nona-3,6-dienyl]sulfanylpropanoic acid is sourced from PubChem (CID 11128065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).