C24H35IN4O — CID 111282280
1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 111282280) has the molecular formula C24H35IN4O and a molecular weight of 522.48 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111282280 |
| Molecular Formula | C24H35IN4O |
| Molecular Weight | 522.48 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-[(2-methoxyphenyl)methyl]-1,2-dimethyl-3-[[1-(2-phenylethyl)pyrrolidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC1CCN(CCc2ccccc2)C1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C24H34N4O.HI/c1-25-24(27(2)19-22-11-7-8-12-23(22)29-3)26-17-21-14-16-28(18-21)15-13-20-9-5-4-6-10-20;/h4-12,21H,13-19H2,1-3H3,(H,25,26);1H |
| InChIKey | FHOVGUPTVHDGSD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|