C22H32IN3O2S — CID 111282996
3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111282996) has the molecular formula C22H32IN3O2S and a molecular weight of 529.49 g/mol. Its IUPAC name is 3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111282996 |
| Molecular Formula | C22H32IN3O2S |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | 3-ethyl-1-[(4-ethylphenyl)methyl]-1-methyl-2-[[4-(methylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CS(C)(=O)=O)cc1)N(C)Cc1ccc(CC)cc1.I |
| InChI | InChI=1S/C22H31N3O2S.HI/c1-5-18-7-11-20(12-8-18)16-25(3)22(23-6-2)24-15-19-9-13-21(14-10-19)17-28(4,26)27;/h7-14H,5-6,15-17H2,1-4H3,(H,23,24);1H |
| InChIKey | JQHYAACYAVHLIK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|