C12H27N5 — CID 11128455
2-[N,N'-di(propan-2-yl)carbamimidoyl]-1,1,3,3-tetramethylguanidine (PubChem CID 11128455) has the molecular formula C12H27N5 and a molecular weight of 241.38 g/mol. Its IUPAC name is 2-[N,N'-di(propan-2-yl)carbamimidoyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[N,N'-di(propan-2-yl)carbamimidoyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 11128455 |
| Molecular Formula | C12H27N5 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.23 |
| IUPAC Name | 2-[N,N'-di(propan-2-yl)carbamimidoyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CC(C)/N=C(/N=C(N(C)C)N(C)C)NC(C)C |
| InChI | InChI=1S/C12H27N5/c1-9(2)13-11(14-10(3)4)15-12(16(5)6)17(7)8/h9-10H,1-8H3,(H,13,14) |
| InChIKey | UCRXZJYCOMRCER-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|