C14H19NO3 — CID 11128696
(1R,2S,3S,4R,5R)-1-benzyl-2-ethenyl-5-methyl-1-oxidopyrrolidin-1-ium-3,4-diol (PubChem CID 11128696) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (1R,2S,3S,4R,5R)-1-benzyl-2-ethenyl-5-methyl-1-oxidopyrrolidin-1-ium-3,4-diol.
| Compound Name | (1R,2S,3S,4R,5R)-1-benzyl-2-ethenyl-5-methyl-1-oxidopyrrolidin-1-ium-3,4-diol |
|---|---|
| PubChem CID | 11128696 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (1R,2S,3S,4R,5R)-1-benzyl-2-ethenyl-5-methyl-1-oxidopyrrolidin-1-ium-3,4-diol |
| SMILES | C=C[C@H]1[C@H](O)[C@H](O)[C@@H](C)[N@+]1([O-])Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO3/c1-3-12-14(17)13(16)10(2)15(12,18)9-11-7-5-4-6-8-11/h3-8,10,12-14,16-17H,1,9H2,2H3/t10-,12+,13-,14+,15-/m1/s1 |
| InChIKey | UHHMEFCHSGFDCS-MYBUGEPTSA-N |
| XLogP | 1.18 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|